CAS 7383-90-6 appears in our catalog under these names: 1-methyl-3-(4-methylphenyl)benzene, 95%, 3,4'-Dimethylbiphenyl 95%, 1-methyl-3-(4-methylphenyl)benzene, 95%, 95%, 3,4'-DIMETHYLBIPHENYL, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
1-methyl-3-(4-methylphenyl)benzene (CAS 7383-90-6) is a chemical compound with the molecular formula C14H14 and a molecular weight of 182.26 g/mol. IUPAC name: 1-methyl-3-(4-methylphenyl)benzene. InChIKey: RBIDPZJTXCPESJ-UHFFFAOYSA-N.
| Molecular formula | C14H14 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 1-methyl-3-(4-methylphenyl)benzene |
| InChIKey | RBIDPZJTXCPESJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)