CAS 613-33-2 appears in our catalog under these names: 4,4′–Dimethylbiphenyl, 4,4'-Dimethylbiphenyl, 99% , 4,4'-Dimethylbiphenyl, 4,4'-Dimethylbiphenyl, >97.0%(GC), 4,4'-Dimethyldiphenyl 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 500g, 1g, 5g, 25g, 1000g, 100g, 10g, 1kg.
1-methyl-4-(4-methylphenyl)benzene (CAS 613-33-2) is a chemical compound with the molecular formula C14H14 and a molecular weight of 182.26 g/mol. IUPAC name: 1-methyl-4-(4-methylphenyl)benzene. InChIKey: RZTDESRVPFKCBH-UHFFFAOYSA-N.
| Molecular formula | C14H14 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenyl)benzene |
| InChIKey | RZTDESRVPFKCBH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)