Products 17057-88-4
CAS 17057-88-4 appears in our catalog under these names: 3,5-Dimethyl-biphenyl, 95%, 3,5-Dimethyl-1,1'-biphenyl, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1,3-dimethyl-5-phenylbenzene (CAS 17057-88-4) is a chemical compound with the molecular formula C14H14 and a molecular weight of 182.26 g/mol. IUPAC name: 1,3-dimethyl-5-phenylbenzene. InChIKey: QUHIUAFQBFDMIQ-UHFFFAOYSA-N.
| Molecular formula | C14H14 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 1,3-dimethyl-5-phenylbenzene |
| InChIKey | QUHIUAFQBFDMIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dimethyl-1,1'-biphenyl, 3,5-dimethylbiphenyl, 3,5-Dimethyl-biphenyl, 1,3-dimethyl-5-phenylbenzene, 1,1'-Biphenyl,3,5-dimethyl-, 1,1'-Biphenyl, 3,5-dimethyl-, Biphenyl, 3,5-dimethyl-, 3,5-Dimethyl-biphenyl (>85%), 3,5-Dimethyl-biphenyl (>75%), 3,5-Dimethyl-1,1'-biphenyl; 3,5-Dimethylbiphenyl;