Products 612-75-9
CAS 612-75-9 appears in our catalog under these names: 3,3'–Dimethylbiphenyl, 3,3'-Dimethylbiphenyl, >98.0%(GC), 3,3'-Dimethyl-1,1'-biphenyl 98%, 3,3'-DIMETHYLBIPHENYL, 99%, 3,3'-Dimethyl-1,1'-biphenyl, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25ml, 5ml, 5g, 25g, 1G, 50g, 100g, 250g.
1-methyl-3-(3-methylphenyl)benzene (CAS 612-75-9) is a chemical compound with the molecular formula C14H14 and a molecular weight of 182.26 g/mol. IUPAC name: 1-methyl-3-(3-methylphenyl)benzene. InChIKey: GVEDOIATHPCYGS-UHFFFAOYSA-N.
| Molecular formula | C14H14 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 1-methyl-3-(3-methylphenyl)benzene |
| InChIKey | GVEDOIATHPCYGS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)
Synonyms:
m,m'-Bitolyl, 1,1'-Biphenyl, 3,3'-dimethyl-, 3,3'-Ditolyl, 1-Methyl-3-(3'-methylphenyl)benzene, 3,3'-Dimethyldiphenyl, 3,3-Dimethyldiphenyl, Biphenyl, 3,3'-dimethyl-, 1,1'-Biphenyl, 3,3'-dimethyl-(9CI), GVEDOIATHPCYGS-UHFFFAOYSA-N, InChI=1/C14H14/c1-11-5-3-7-13(9-11)14-8-4-6-12(2)10-14/h3-10H,1-2H