cas: 1660-93-1 — see every product listed under this CAS number, including other names
3,4,7,8-Tetramethyl-1,10-phenanthroline 95% (CAS 1660-93-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145297-250mg |
| cas | 1660-93-1 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 681.88 Pln | |
| Ambeed | 100g | 2306.13 Pln | |
| Ambeed | 500g | 11239.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A145297 |
3,4,7,8-tetramethyl-1,10-phenanthroline (CAS 1660-93-1) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: 3,4,7,8-tetramethyl-1,10-phenanthroline. InChIKey: NPAXPTHCUCUHPT-UHFFFAOYSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 3,4,7,8-tetramethyl-1,10-phenanthroline |
| InChIKey | NPAXPTHCUCUHPT-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=C1C)C=CC3=C(C(=CN=C32)C)C |
Computed by PubChem (NCBI)