CAS 1660-93-1 appears in our catalog under these names: 3,4,7,8-Tetramethyl-1,10-phenanthroline/ 99+%, 3,4,7,8-Tetramethyl-1,10-phenanthroline, 97%, 3,4,7,8-Tetramethyl-1,10-phenanthroline, >95% (HPLC), 3,4,7,8–Tetramethyl–1,10–phenanthroline, 3,4,7,8-Tetramethyl-1,10-phenanthroline, 98+% . Offered by: Chemat, Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 10g, 5g, 25g, 100g, 2,5g, 0,1kg, 0,05kg.
3,4,7,8-tetramethyl-1,10-phenanthroline (CAS 1660-93-1) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: 3,4,7,8-tetramethyl-1,10-phenanthroline. InChIKey: NPAXPTHCUCUHPT-UHFFFAOYSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 3,4,7,8-tetramethyl-1,10-phenanthroline |
| InChIKey | NPAXPTHCUCUHPT-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=C1C)C=CC3=C(C(=CN=C32)C)C |
Computed by PubChem (NCBI)