cas: 59548-39-9 — see every product listed under this CAS number, including other names
3,4-Diaminoanisole dihydrochloride, 98% (CAS 59548-39-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 396990010 |
| cas | 59548-39-9 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 129.18 Pln | |
| Thermo Scientific (Acros) | 5g | 439.21 Pln | |
| Thermo Scientific (Acros) | 25g | 1652.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
4-methoxybenzene-1,2-diamine;dihydrochloride (CAS 59548-39-9) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 4-methoxybenzene-1,2-diamine;dihydrochloride. InChIKey: SXCHMHOBHJOXGC-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-methoxybenzene-1,2-diamine;dihydrochloride |
| InChIKey | SXCHMHOBHJOXGC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)