cas: 59548-39-9 — see every product listed under this CAS number, including other names
4-Methoxybenzene-1,2-diamine dihydrochloride, 95%, 95% (CAS 59548-39-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LO2-1g |
| cas | 59548-39-9 |
| size | 1g |
| availability | 800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 669.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxybenzene-1,2-diamine;dihydrochloride (CAS 59548-39-9) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 4-methoxybenzene-1,2-diamine;dihydrochloride. InChIKey: SXCHMHOBHJOXGC-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-methoxybenzene-1,2-diamine;dihydrochloride |
| InChIKey | SXCHMHOBHJOXGC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)