cas: 5836-54-4 — see every product listed under this CAS number, including other names
3,4-Dichloro-N-methylbenzenesulfonamide, 98% (CAS 5836-54-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 25g. Offered by: AmBeed, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A284270-10g |
| cas | 5836-54-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 15622.39 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Fluorochem | 100mg | 617.51 Pln | |
| Fluorochem | 250mg | 1044.44 Pln | |
| Fluorochem | 500mg | 1726.49 Pln | |
| Fluorochem | 1g | 2392.93 Pln | |
| Fluorochem | 2.5g | 4610.89 Pln | |
| Fluorochem | 5g | 6651.84 Pln | |
| Fluorochem | 10g | 9838.22 Pln | |
| Fluorochem | 25g | 22568.11 Pln | |
| Fluorochem | 100g | 78855.58 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-dichloro-N-methylbenzenesulfonamide (CAS 5836-54-4) is a chemical compound with the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. IUPAC name: 3,4-dichloro-N-methylbenzenesulfonamide. InChIKey: HRRNFMGIBBKSTL-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2S |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | 3,4-dichloro-N-methylbenzenesulfonamide |
| InChIKey | HRRNFMGIBBKSTL-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)