CAS 5836-54-4 appears in our catalog under these names: 3,4-Dichloro-N-methylbenzenesulfonamide, 98%, 3,4-Dichloro-n-methylbenzenesulfonamide, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 500mg, 2.5g, 25g.
3,4-dichloro-N-methylbenzenesulfonamide (CAS 5836-54-4) is a chemical compound with the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. IUPAC name: 3,4-dichloro-N-methylbenzenesulfonamide. InChIKey: HRRNFMGIBBKSTL-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2S |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | 3,4-dichloro-N-methylbenzenesulfonamide |
| InChIKey | HRRNFMGIBBKSTL-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)