Products 103482-25-3
CAS 103482-25-3 is the registry number for (2,6-Dichlorophenyl)methanesulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2,6-dichlorophenyl)methanesulfonamide (CAS 103482-25-3) is a chemical compound with the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. IUPAC name: (2,6-dichlorophenyl)methanesulfonamide. InChIKey: SUSWTMGLRJUBOE-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2S |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | (2,6-dichlorophenyl)methanesulfonamide |
| InChIKey | SUSWTMGLRJUBOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CS(=O)(=O)N)Cl |
Computed by PubChem (NCBI)