CAS 1864483-95-3 is the registry number for 2,6-Dichloro-4-[(methylsulfonyl)methyl]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloro-4-(methylsulfonylmethyl)pyridine (CAS 1864483-95-3) is a chemical compound with the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. IUPAC name: 2,6-dichloro-4-(methylsulfonylmethyl)pyridine. InChIKey: RXEMIIGQMCPAGE-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2S |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | 2,6-dichloro-4-(methylsulfonylmethyl)pyridine |
| InChIKey | RXEMIIGQMCPAGE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC(=NC(=C1)Cl)Cl |
Computed by PubChem (NCBI)