3,4-Dichlorophenylacetone, 98%
cas: 6097-32-1 — see every product listed under this CAS number, including other names
3,4-Dichlorophenylacetone, 98% (CAS 6097-32-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A680141-250mg |
| cas | 6097-32-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 498.31 Pln | |
| Ambeed | 5g | 1616.38 Pln | |
| Ambeed | 10g | 2906.88 Pln | |
| Ambeed | 25g | 5749.31 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 530.95 Pln | |
| BLDpharm | 5g | 1736.08 Pln | |
| BLDpharm | 10g | 2846.80 Pln | |
| BLDpharm | 25g | 5629.15 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(3,4-dichlorophenyl)propan-2-one (CAS 6097-32-1) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)propan-2-one. InChIKey: AJUAASWQUWIMHM-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)propan-2-one |
| InChIKey | AJUAASWQUWIMHM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)