CAS 93457-07-9 appears in our catalog under these names: 2,4-Dichlorophenylacetone, 95%, 2,4–Dichlorophenylacetone, 2,4-Dichlorophenylacetone, >98.0%(GC). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 5g, 25g, 1g.
1-(2,4-dichlorophenyl)propan-2-one (CAS 93457-07-9) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)propan-2-one. InChIKey: ITVVHXZQWSCZBC-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)propan-2-one |
| InChIKey | ITVVHXZQWSCZBC-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)