Products 1188143-94-3
CAS 1188143-94-3 appears in our catalog under these names: 4,6-Dichloro-2,3-dihydro-1h-inden-1-ol, 95%, 4,6-Dichloro-2,3-dihydro-1H-inden-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
4,6-dichloro-2,3-dihydro-1H-inden-1-ol (CAS 1188143-94-3) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 4,6-dichloro-2,3-dihydro-1H-inden-1-ol. InChIKey: ZIMJJJUNFVBXJO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 4,6-dichloro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | ZIMJJJUNFVBXJO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)