Products 1188144-09-3
CAS 1188144-09-3 appears in our catalog under these names: 5,7-Dichloro-2,3-dihydro-1h-inden-1-ol, 95%, 5,7-Dichloro-2,3-dihydro-1H-inden-1-ol, 97%, 5,7-Dichloro-2,3-dihydro-1H-inden-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
5,7-dichloro-2,3-dihydro-1H-inden-1-ol (CAS 1188144-09-3) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 5,7-dichloro-2,3-dihydro-1H-inden-1-ol. InChIKey: MSBZPTHVBLQOPJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 5,7-dichloro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | MSBZPTHVBLQOPJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)