CAS 102052-40-4 appears in our catalog under these names: 1-(2,5-Dichlorophenyl)propan-2-one, 95%, (2,5-Dichlorophenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
1-(2,5-dichlorophenyl)propan-2-one (CAS 102052-40-4) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)propan-2-one. InChIKey: CVYJYBCSHUBZTM-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)propan-2-one |
| InChIKey | CVYJYBCSHUBZTM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)