cas: 189283-51-0 — see every product listed under this CAS number, including other names
3,4-Difluoro-2-hydroxybenzoic acid (CAS 189283-51-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013026-250MG |
| cas | 189283-51-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 591.48 Pln | |
| Fluorochem | 25g | 1190.22 Pln |
| delivery time | 1-2 weeks |
|---|
3,4-difluoro-2-hydroxybenzoic acid (CAS 189283-51-0) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 3,4-difluoro-2-hydroxybenzoic acid. InChIKey: GWOOBUWKTOCYKY-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 3,4-difluoro-2-hydroxybenzoic acid |
| InChIKey | GWOOBUWKTOCYKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)O)F)F |
Computed by PubChem (NCBI)