cas: 369-34-6 — see every product listed under this CAS number, including other names
3,4-Difluoronitrobenzene 98% (CAS 369-34-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100g, 500g, 25g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A279035-5g |
| cas | 369-34-6 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 100g | 253.56 Pln | |
| Ambeed | 500g | 464.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 1000g | 743.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A279035 |
1,2-difluoro-4-nitrobenzene (CAS 369-34-6) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,2-difluoro-4-nitrobenzene. InChIKey: RUBQQRMAWLSCCJ-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,2-difluoro-4-nitrobenzene |
| InChIKey | RUBQQRMAWLSCCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)