cas: 20825-89-2 — see every product listed under this CAS number, including other names
3,4-Dihydro-2H-1,5-benzodioxepine-7-carboxylic acid, 97% (CAS 20825-89-2) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC13201CB |
| cas | 20825-89-2 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 143.05 Pln | |
| Thermo Scientific | 1g | 378.25 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylic acid (CAS 20825-89-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylic acid. InChIKey: MQSSBVLREFSMDP-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylic acid |
| InChIKey | MQSSBVLREFSMDP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)C(=O)O)OC1 |
Computed by PubChem (NCBI)