cas: 20825-89-2 — see every product listed under this CAS number, including other names
3,4-Dihydro-2H-benzo(b)(1,4)dioxepine-7-carboxylic acid, 98% (CAS 20825-89-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A452003-1g |
| cas | 20825-89-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 460.60 Pln | |
| AmBeed | 25g | 5356.12 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylic acid (CAS 20825-89-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylic acid. InChIKey: MQSSBVLREFSMDP-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylic acid |
| InChIKey | MQSSBVLREFSMDP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)C(=O)O)OC1 |
Computed by PubChem (NCBI)