cas: 74169-52-1 — see every product listed under this CAS number, including other names
3,4-Dimethyl-1-phenylpyrano[2,3-c]pyrazol-6(1H)-one, 98% (CAS 74169-52-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F764892-100MG |
| cas | 74169-52-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 4131.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one (CAS 74169-52-1) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one. InChIKey: BCRIECZRUAGVHD-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one |
| InChIKey | BCRIECZRUAGVHD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C(=NN2C3=CC=CC=C3)C |
Computed by PubChem (NCBI)