CAS 1017198-88-7 is the registry number for 5-Amino-3-benzyl-2,3-dihydro-1,3-benzoxazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-amino-3-benzyl-1,3-benzoxazol-2-one (CAS 1017198-88-7) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 5-amino-3-benzyl-1,3-benzoxazol-2-one. InChIKey: VTFQUUZGVFAYCS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 5-amino-3-benzyl-1,3-benzoxazol-2-one |
| InChIKey | VTFQUUZGVFAYCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=CC(=C3)N)OC2=O |
Computed by PubChem (NCBI)