CAS 86-20-4 appears in our catalog under these names: 9-Ethyl-3-nitrocarbazole, 95%, 9-Ethyl-3-nitro-9H-carbazole 98%, 9-ETHYL-3-NITROCARBAZOLE, 98%, 9-Ethyl-3-nitro-9H-carbazole, 98%, 98%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
9-ethyl-3-nitrocarbazole (CAS 86-20-4) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 9-ethyl-3-nitrocarbazole. InChIKey: WONHLSYSHMRRGO-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 9-ethyl-3-nitrocarbazole |
| InChIKey | WONHLSYSHMRRGO-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)[N+](=O)[O-])C3=CC=CC=C31 |
Computed by PubChem (NCBI)