CAS 54995-53-8 is the registry number for 2-(4-Methoxyphenyl)-1,3-benzoxazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine (CAS 54995-53-8) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine. InChIKey: CZSVPGARXVXXOX-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1,3-benzoxazol-5-amine |
| InChIKey | CZSVPGARXVXXOX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)