Products 78772-74-4
CAS 78772-74-4 appears in our catalog under these names: 5-Methyl-5-(naphthalen-2-yl)imidazolidine-2,4-dione, 95%, 5-Methyl-5-(naphthalen-2-yl)imidazolidine-2,4-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (CAS 78772-74-4) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione. InChIKey: IZHDQRZCNDMXAH-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| InChIKey | IZHDQRZCNDMXAH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)