CAS 1000025-93-3 appears in our catalog under these names: 3,5–Bis(benzyloxy)picolinic acid, 3,5-Bis(benzyloxy)picolinic acid, 97%, 97%, 3,5-Bis-benzyloxypyridine-2-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid (CAS 1000025-93-3) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid. InChIKey: OEJYKWLDGWAOIF-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid |
| InChIKey | OEJYKWLDGWAOIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(N=C2)C(=O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)