Products 94111-75-8

CAS 94111-75-8 appears in our catalog under these names: 3,5-Bis(bromomethyl)benzoic acid, 97%, 97%, 3,5-BIS(BROMOMETHYL)BENZOIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

3,5-bis(bromomethyl)benzoic acid (CAS 94111-75-8) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 3,5-bis(bromomethyl)benzoic acid. InChIKey: RZTUPNXWTOBHSY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Br2O2
Molecular weight307.97 g/mol
IUPAC name3,5-bis(bromomethyl)benzoic acid
InChIKeyRZTUPNXWTOBHSY-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1CBr)C(=O)O)CBr

Computed by PubChem (NCBI)