CAS 94111-75-8 appears in our catalog under these names: 3,5-Bis(bromomethyl)benzoic acid, 97%, 97%, 3,5-BIS(BROMOMETHYL)BENZOIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3,5-bis(bromomethyl)benzoic acid (CAS 94111-75-8) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 3,5-bis(bromomethyl)benzoic acid. InChIKey: RZTUPNXWTOBHSY-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 3,5-bis(bromomethyl)benzoic acid |
| InChIKey | RZTUPNXWTOBHSY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1CBr)C(=O)O)CBr |
Computed by PubChem (NCBI)