cas: 75462-59-8 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)benzyl Chloride, >97.0%(GC) (CAS 75462-59-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3641-5G |
| cas | 75462-59-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 296.86 Pln | |
| TCI | 25g | 704.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene (CAS 75462-59-8) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene. InChIKey: OINTXXMBRBLMHH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene |
| InChIKey | OINTXXMBRBLMHH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CCl |
Computed by PubChem (NCBI)