cas: 2402-99-5 — see every product listed under this CAS number, including other names
3,5-Dibromopyridine N-Oxide, >98.0%(GC) (CAS 2402-99-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D4326-1G |
| cas | 2402-99-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 177.35 Pln | |
| TCI | 5g | 536.31 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
3,5-dibromo-1-oxidopyridin-1-ium (CAS 2402-99-5) is a chemical compound with the molecular formula C5H3Br2NO and a molecular weight of 252.89 g/mol. IUPAC name: 3,5-dibromo-1-oxidopyridin-1-ium. InChIKey: QBUQQUOGXPOBAQ-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2NO |
|---|---|
| Molecular weight | 252.89 g/mol |
| IUPAC name | 3,5-dibromo-1-oxidopyridin-1-ium |
| InChIKey | QBUQQUOGXPOBAQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=[N+](C=C1Br)[O-])Br |
Computed by PubChem (NCBI)