cas: 2402-99-5 — see every product listed under this CAS number, including other names
3,5-Dibromopyridine1-Oxide, 98%, 98% (CAS 2402-99-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118OA7-250mg |
| cas | 2402-99-5 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 707.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-dibromo-1-oxidopyridin-1-ium (CAS 2402-99-5) is a chemical compound with the molecular formula C5H3Br2NO and a molecular weight of 252.89 g/mol. IUPAC name: 3,5-dibromo-1-oxidopyridin-1-ium. InChIKey: QBUQQUOGXPOBAQ-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2NO |
|---|---|
| Molecular weight | 252.89 g/mol |
| IUPAC name | 3,5-dibromo-1-oxidopyridin-1-ium |
| InChIKey | QBUQQUOGXPOBAQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=[N+](C=C1Br)[O-])Br |
Computed by PubChem (NCBI)