cas: 2402-99-5 — see every product listed under this CAS number, including other names
3,5-Dibromopyridine N-oxide, 98% (CAS 2402-99-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092663-250MG |
| cas | 2402-99-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 25g | 1257.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dibromo-1-oxidopyridin-1-ium (CAS 2402-99-5) is a chemical compound with the molecular formula C5H3Br2NO and a molecular weight of 252.89 g/mol. IUPAC name: 3,5-dibromo-1-oxidopyridin-1-ium. InChIKey: QBUQQUOGXPOBAQ-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2NO |
|---|---|
| Molecular weight | 252.89 g/mol |
| IUPAC name | 3,5-dibromo-1-oxidopyridin-1-ium |
| InChIKey | QBUQQUOGXPOBAQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=[N+](C=C1Br)[O-])Br |
Computed by PubChem (NCBI)