cas: 1394964-34-1 — see every product listed under this CAS number, including other names
3,5-Dichloro-2-isopropoxypyridine, 98% (CAS 1394964-34-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F764138-100MG |
| cas | 1394964-34-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 1257.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dichloro-2-propan-2-yloxypyridine (CAS 1394964-34-1) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 3,5-dichloro-2-propan-2-yloxypyridine. InChIKey: CNVKZXVUPQCIKM-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 3,5-dichloro-2-propan-2-yloxypyridine |
| InChIKey | CNVKZXVUPQCIKM-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)