CAS 5467-71-0 appears in our catalog under these names: 2-Amino-1-(4-chlorophenyl)ethanone hydrochloride, 98%, 2-Amino-4'-chloroacetophenone hydrochloride, 2-Amino-1-(4-chlorophenyl)ethanone hydrochloride, 98%, 98%, 2-Amino-1-(4-chloro-phenyl)-ethanone, hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 1g, 25g, 5g, 2g, 250mg.
2-amino-1-(4-chlorophenyl)ethanone;hydrochloride (CAS 5467-71-0) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 2-amino-1-(4-chlorophenyl)ethanone;hydrochloride. InChIKey: OVKMQHKVUWBLSV-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-amino-1-(4-chlorophenyl)ethanone;hydrochloride |
| InChIKey | OVKMQHKVUWBLSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CN)Cl.Cl |
Computed by PubChem (NCBI)