cas: 957120-97-7 — see every product listed under this CAS number, including other names
3,5-Dichloro-2-methylphenylboronic acid, 95%, 95% (CAS 957120-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H91T-250mg |
| cas | 957120-97-7 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 1g | 1082.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3,5-dichloro-2-methylphenyl)boronic acid (CAS 957120-97-7) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (3,5-dichloro-2-methylphenyl)boronic acid. InChIKey: SHLANOIYUAXDGG-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (3,5-dichloro-2-methylphenyl)boronic acid |
| InChIKey | SHLANOIYUAXDGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1C)Cl)Cl)(O)O |
Computed by PubChem (NCBI)