3,5-Dichloro-4-fluorophenylboronic acid, 98%, 98%
cas: 1646614-31-4 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-fluorophenylboronic acid, 98%, 98% (CAS 1646614-31-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZ4R-100mg |
| cas | 1646614-31-4 |
| size | 100mg |
| availability | 47.75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 822.80 Pln | |
| Chemat | 10g | 1586.00 Pln | |
| Chemat | 25g | 3866.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,5-dichloro-4-fluorophenyl)boronic acid (CAS 1646614-31-4) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,5-dichloro-4-fluorophenyl)boronic acid. InChIKey: OKZYLWQCOUTIMV-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (3,5-dichloro-4-fluorophenyl)boronic acid |
| InChIKey | OKZYLWQCOUTIMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)F)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3,5-dichloro-4-fluorophenyl)boronic acid, 3,5-Dichloro-4-fluorophenylboronic acid, 3,5-Dichloro-4-fluorophenylboronic acid(contains varying amounts of Anhydride), 3,5-Dichloro-4-fluorophenylboronicacid, (3,5-dichloro-4-fluoro-phenyl)boronic acid, B-(3,5-dichloro-4-fluorophenyl)boronic acid, Boronic acid, B-(3,5-dichloro-4-fluorophenyl)-, (3,5-Dichloro-4-fluorophenyl)boronic acid - [D89266]