cas: 1646614-31-4 — see every product listed under this CAS number, including other names
(3,5-Dichloro-4-fluorophenyl)boronic acid, 97% (CAS 1646614-31-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620992-250MG |
| cas | 1646614-31-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 950.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3,5-dichloro-4-fluorophenyl)boronic acid (CAS 1646614-31-4) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,5-dichloro-4-fluorophenyl)boronic acid. InChIKey: OKZYLWQCOUTIMV-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (3,5-dichloro-4-fluorophenyl)boronic acid |
| InChIKey | OKZYLWQCOUTIMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)F)Cl)(O)O |
Computed by PubChem (NCBI)