Products 1160561-29-4

CAS 1160561-29-4 appears in our catalog under these names: 3,4-Dichloro-2-fluorophenylboronic acid, 95%, (3,4-Dichloro-2-fluorophenyl)boronic acid, 98%, (3,4-Dichloro-2-fluorophenyl)boronic acid, (3,4-Dichloro-2-fluorophenyl)boronic acid, ≥95%, ≥95%, 3,4-Dichloro-2-fluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg, 100mg.

Structural formula: {0} (CAS {1})

(3,4-dichloro-2-fluorophenyl)boronic acid (CAS 1160561-29-4) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,4-dichloro-2-fluorophenyl)boronic acid. InChIKey: VAGMFOMFJZBNKB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BCl2FO2
Molecular weight208.81 g/mol
IUPAC name(3,4-dichloro-2-fluorophenyl)boronic acid
InChIKeyVAGMFOMFJZBNKB-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)Cl)Cl)F)(O)O

Computed by PubChem (NCBI)