cas: 1952315-15-9 — see every product listed under this CAS number, including other names
3,5-Dichloropyrido[3,4-b]Pyrazine, 95%, 95% (CAS 1952315-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KWMH-100mg |
| cas | 1952315-15-9 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 798.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-dichloropyrido[3,4-b]pyrazine (CAS 1952315-15-9) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 3,5-dichloropyrido[3,4-b]pyrazine. InChIKey: XQWKBASAHGOZIW-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 3,5-dichloropyrido[3,4-b]pyrazine |
| InChIKey | XQWKBASAHGOZIW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=NC(=CN=C21)Cl)Cl |
Computed by PubChem (NCBI)