CAS 1260663-37-3 appears in our catalog under these names: 4,8-Dichloropyrido[3,4-d]pyrimidine, 95%, 4,8-Dichloropyrido(3,4-d)pyrimidine, 97%, 4,8-Dichloropyrido[3,4-d]pyrimidine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4,8-dichloropyrido[3,4-d]pyrimidine (CAS 1260663-37-3) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 4,8-dichloropyrido[3,4-d]pyrimidine. InChIKey: YXWADPHHQXVLEL-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 4,8-dichloropyrido[3,4-d]pyrimidine |
| InChIKey | YXWADPHHQXVLEL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)