CAS 552331-44-9 appears in our catalog under these names: 4,7-Dichloro-pyrido[2,3-d]pyrimidine, 95%, 4,7-Dichloropyrido(2,3-d)pyrimidine, 97%, 4,7-dichloropyrido(2,3-d)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 10g, 0,5g, 50mg.
4,7-dichloropyrido[2,3-d]pyrimidine (CAS 552331-44-9) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 4,7-dichloropyrido[2,3-d]pyrimidine. InChIKey: VRXZQRLAIVDILJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 4,7-dichloropyrido[2,3-d]pyrimidine |
| InChIKey | VRXZQRLAIVDILJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)