CAS 1952315-15-9 appears in our catalog under these names: 3,5-Dichloropyrido[3,4-b]pyrazine, 95%, 3,5-Dichloropyrido[3,4-b]Pyrazine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
3,5-dichloropyrido[3,4-b]pyrazine (CAS 1952315-15-9) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 3,5-dichloropyrido[3,4-b]pyrazine. InChIKey: XQWKBASAHGOZIW-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 3,5-dichloropyrido[3,4-b]pyrazine |
| InChIKey | XQWKBASAHGOZIW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=NC(=CN=C21)Cl)Cl |
Computed by PubChem (NCBI)