CAS 1283075-60-4 appears in our catalog under these names: 6,8-Dichloropyrido[2,3-b]pyrazine, 95%, 6,8–Dichloropyrido(2,3–b)pyrazine, 6,8-Dichloropyrido[2,3-b]pyrazine, 97%, 97%, 6,8-Dichloropyrido[2,3-b]pyrazine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
6,8-dichloropyrido[2,3-b]pyrazine (CAS 1283075-60-4) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 6,8-dichloropyrido[2,3-b]pyrazine. InChIKey: BIULHHKFNLFURG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 6,8-dichloropyrido[2,3-b]pyrazine |
| InChIKey | BIULHHKFNLFURG-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)