cas: 51707-38-1 — see every product listed under this CAS number, including other names
3,5-Dimethoxybenzohydrazide 98% (CAS 51707-38-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A457036-1g |
| cas | 51707-38-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 659.62 Pln | |
| Ambeed | 25g | 909.94 Pln | |
| Ambeed | 100g | 3418.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A457036 |
3,5-dimethoxybenzohydrazide (CAS 51707-38-1) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 3,5-dimethoxybenzohydrazide. InChIKey: DOWVACHORBOSEF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3,5-dimethoxybenzohydrazide |
| InChIKey | DOWVACHORBOSEF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)NN)OC |
Computed by PubChem (NCBI)