cas: 61226-19-5 — see every product listed under this CAS number, including other names
3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid, ≥97%, ≥97% (CAS 61226-19-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EFGW-1g |
| cas | 61226-19-5 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 5g | 1086.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid (CAS 61226-19-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid. InChIKey: LPYTYYLNGJGJGW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | LPYTYYLNGJGJGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(=O)O |
Computed by PubChem (NCBI)