cas: 61226-19-5 — see every product listed under this CAS number, including other names
3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid, 97% (CAS 61226-19-5) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO00744CB |
| cas | 61226-19-5 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 243.85 Pln | |
| Thermo Scientific | 1g | 615.99 Pln | |
| Thermo Scientific | 10g | 2855.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid (CAS 61226-19-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid. InChIKey: LPYTYYLNGJGJGW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | LPYTYYLNGJGJGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(=O)O |
Computed by PubChem (NCBI)