cas: 61226-19-5 — see every product listed under this CAS number, including other names
3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid, 98+% (CAS 61226-19-5) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A832771-10g |
| cas | 61226-19-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 5108.74 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid (CAS 61226-19-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid. InChIKey: LPYTYYLNGJGJGW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | LPYTYYLNGJGJGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(=O)O |
Computed by PubChem (NCBI)