CAS 80466-78-0 appears in our catalog under these names: 3,5-Dimethyl-1h-pyrazole-4-sulfonyl chloride hydrochloride, 95%, 3,5-Dimethyl-1h-pyrazole-4-sulfonyl chloride, 95%, 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride, 97% , 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 25g, 500mg, 2.5g.
3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride (CAS 80466-78-0) is a chemical compound with the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. IUPAC name: 3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride. InChIKey: NBGSZCQLPLYKJH-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride |
| InChIKey | NBGSZCQLPLYKJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)