Products 80466-78-0

CAS 80466-78-0 appears in our catalog under these names: 3,5-Dimethyl-1h-pyrazole-4-sulfonyl chloride hydrochloride, 95%, 3,5-Dimethyl-1h-pyrazole-4-sulfonyl chloride, 95%, 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride, 97% , 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride 95%, 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 25g, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride (CAS 80466-78-0) is a chemical compound with the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. IUPAC name: 3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride. InChIKey: NBGSZCQLPLYKJH-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7ClN2O2S
Molecular weight194.64 g/mol
IUPAC name3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride
InChIKeyNBGSZCQLPLYKJH-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)