Products 1418117-90-4
CAS 1418117-90-4 appears in our catalog under these names: 2-(Aminomethyl)-5-nitrothiophene hydrochloride, 95%, 2-(Aminomethyl)-5-nitrothiophene Hydrochloride, 97+%, 2–(Aminomethyl)–5–nitrothiophene Hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg, 50mg.
(5-nitrothiophen-2-yl)methanamine;hydrochloride (CAS 1418117-90-4) is a chemical compound with the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. IUPAC name: (5-nitrothiophen-2-yl)methanamine;hydrochloride. InChIKey: YYXXJIRIYPXWFC-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | (5-nitrothiophen-2-yl)methanamine;hydrochloride |
| InChIKey | YYXXJIRIYPXWFC-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)[N+](=O)[O-])CN.Cl |
Computed by PubChem (NCBI)